3H-Phenoxazine-1,9-dicarboxylicacid, 2-amino-4,6-dimethyl-3-oxo-, 1,9-bis[2-(1-piperidinyl)ethyl] ester structure
|
Common Name | 3H-Phenoxazine-1,9-dicarboxylicacid, 2-amino-4,6-dimethyl-3-oxo-, 1,9-bis[2-(1-piperidinyl)ethyl] ester | ||
|---|---|---|---|---|
| CAS Number | 63879-40-3 | Molecular Weight | 550.64600 | |
| Density | 1.36g/cm3 | Boiling Point | 729ºC at 760mmHg | |
| Molecular Formula | C30H38N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 394.7ºC | |
| Name | bis(2-piperidin-1-ylethyl) 2-amino-4,6-dimethyl-3-oxophenoxazine-1,9-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 729ºC at 760mmHg |
| Molecular Formula | C30H38N4O6 |
| Molecular Weight | 550.64600 |
| Flash Point | 394.7ºC |
| Exact Mass | 550.27900 |
| PSA | 128.20000 |
| LogP | 4.23420 |
| Index of Refraction | 1.648 |
| InChIKey | XUQHMRZBKZOQPP-UHFFFAOYSA-N |
| SMILES | Cc1c2oc3c(C)ccc(C(=O)OCCN4CCCCC4)c3nc-2c(C(=O)OCCN2CCCCC2)c(N)c1=O |
|
~%
3H-Phenoxazine-... CAS#:63879-40-3 |
| Literature: Jain,P.C. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1977 , vol. 15, p. 163 - 164 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3H-Phenoxazine-1,2-amino-4,6-dimethyl-3-oxo-,bis[2-(1-piperidinyl)ethyl] ester |