Benzenesulfonic acid,4-amino-3-chloro-5-methyl-
Modify Date: 2025-08-25 08:47:04
Benzenesulfonic acid,4-amino-3-chloro-5-methyl- structure
|
Common Name | Benzenesulfonic acid,4-amino-3-chloro-5-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6387-14-0 | Molecular Weight | 221.66100 | |
| Density | 1.553g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H8ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-3-chloro-5-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.553g/cm3 |
|---|---|
| Molecular Formula | C7H8ClNO3S |
| Molecular Weight | 221.66100 |
| Exact Mass | 220.99100 |
| PSA | 88.77000 |
| LogP | 3.13930 |
| Index of Refraction | 1.62 |
| InChIKey | DTQVHBIQMCFTSZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(S(=O)(=O)O)cc(Cl)c1N |
| HS Code | 2921430090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:21352-09-0
CAS#:87-63-8| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 228-989-6 |
| Benzenesulfonic acid,4-amino-3-chloro-5-methyl |
| 6-Amino-5-chlorotoluene-3-sulphonic acid |
| m-Toluenesulfonic acid,4-amino-5-chloro |
| 4-Amino-5-chloro-m-toluensulfonic acid |