Nicotinic acid pyridin-3-ylmethyl ester; compound with (E)-but-2-enedioic acid
Modify Date: 2025-09-11 16:31:03
Nicotinic acid pyridin-3-ylmethyl ester; compound with (E)-but-2-enedioic acid structure
|
Common Name | Nicotinic acid pyridin-3-ylmethyl ester; compound with (E)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 63861-52-9 | Molecular Weight | 330.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Nicotinic acid pyridin-3-ylmethyl ester; compound with (E)-but-2-enedioic acid |
|---|
| Molecular Formula | C16H14N2O6 |
|---|---|
| Molecular Weight | 330.29200 |
| Exact Mass | 330.08500 |
| PSA | 126.68000 |
| LogP | 1.54540 |
| InChIKey | IWWXYFKUBKURQF-WLHGVMLRSA-N |
| SMILES | O=C(OCc1ccc[nH+]c1)c1cccnc1.O=C([O-])C=CC(=O)O |