N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine
Modify Date: 2025-08-26 13:40:11
N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine structure
|
Common Name | N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 63812-63-5 | Molecular Weight | 360.32500 | |
| Density | 1.14g/cm3 | Boiling Point | 475.5ºC at 760 mmHg | |
| Molecular Formula | C16H27Cl2N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.4ºC | |
| Name | N-butyl-4,6-dichloro-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 475.5ºC at 760 mmHg |
| Molecular Formula | C16H27Cl2N5 |
| Molecular Weight | 360.32500 |
| Flash Point | 241.4ºC |
| Exact Mass | 359.16400 |
| PSA | 53.94000 |
| LogP | 4.42290 |
| Index of Refraction | 1.525 |
| InChIKey | GFFYOTUTUOQYLA-UHFFFAOYSA-N |
| SMILES | CCCCN(c1nc(Cl)nc(Cl)n1)C1CC(C)(C)NC(C)(C)C1 |
| HS Code | 2933990090 |
|---|
|
~%
N-butyl-4,6-dic... CAS#:63812-63-5 |
| Literature: Chimosa Chimica Organica S.p.A. Patent: US4086204 A1, 1978 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 264-471-6 |