Acetic acid,2-[(1-amino-6-sulfo-2-naphthalenyl)oxy]- structure
|
Common Name | Acetic acid,2-[(1-amino-6-sulfo-2-naphthalenyl)oxy]- | ||
|---|---|---|---|---|
| CAS Number | 6373-39-3 | Molecular Weight | 297.28400 | |
| Density | 1.617g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H11NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-amino-6-sulfonaphthalen-2-yl)oxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.617g/cm3 |
|---|---|
| Molecular Formula | C12H11NO6S |
| Molecular Weight | 297.28400 |
| Exact Mass | 297.03100 |
| PSA | 135.30000 |
| LogP | 2.79410 |
| Index of Refraction | 1.698 |
| InChIKey | XCOGAYHBZJLDOC-UHFFFAOYSA-N |
| SMILES | Nc1c(OCC(=O)O)ccc2cc(S(=O)(=O)O)ccc12 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| [(1-amino-6-sulfonaphthalen-2-yl)oxy]acetic acid |