1-amino-9,10-dioxo-9,10-dihydroanthracene-2-carbaldehyde structure
|
Common Name | 1-amino-9,10-dioxo-9,10-dihydroanthracene-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 6363-87-7 | Molecular Weight | 251.23700 | |
| Density | 1.452g/cm3 | Boiling Point | 538.5ºC at 760 mmHg | |
| Molecular Formula | C15H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.5ºC | |
| Name | 1-amino-9,10-dioxoanthracene-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 538.5ºC at 760 mmHg |
| Molecular Formula | C15H9NO3 |
| Molecular Weight | 251.23700 |
| Flash Point | 279.5ºC |
| Exact Mass | 251.05800 |
| PSA | 77.23000 |
| LogP | 2.43790 |
| Index of Refraction | 1.738 |
| InChIKey | QUPVURNJBGAEQX-UHFFFAOYSA-N |
| SMILES | Nc1c(C=O)ccc2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
|
~%
1-amino-9,10-di... CAS#:6363-87-7 |
| Literature: Cassella and Co. Patent: DE346188 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 395 |
|
~%
1-amino-9,10-di... CAS#:6363-87-7 |
| Literature: I.G. Farbenind. Patent: DE521724 , 1929 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 17, p. 561 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-amino-2-formylanthraquinone |
| 1-Amino-anthrachinon-aldehyd-(2) |
| 1-amino-9,10-dioxo-9,10-dihydro-anthracene-2-carbaldehyde |
| 1-Aminoanthrachinon-2-carbaldehyd |
| 1-Amino-9,10-dioxo-9,10-dihydro-anthracen-2-carbaldehyd |
| 1-Amino-9,10-dioxo-9,10-dihydro-2-anthracenecarbaldehyde |
| 1-amino-anthraquinone-2-aldehyde |