2-amino-3,4,5,6-tetrachloro-phenol structure
|
Common Name | 2-amino-3,4,5,6-tetrachloro-phenol | ||
|---|---|---|---|---|
| CAS Number | 6358-13-0 | Molecular Weight | 246.90600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3Cl4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3,4,5,6-tetrachloro-phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H3Cl4NO |
|---|---|
| Molecular Weight | 246.90600 |
| Exact Mass | 244.89700 |
| PSA | 46.25000 |
| LogP | 4.16920 |
| InChIKey | NLWLQOVVARQQRZ-UHFFFAOYSA-N |
| SMILES | Nc1c(O)c(Cl)c(Cl)c(Cl)c1Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-3,4,5,6-tetrachlor-phenol |