diisononylnaphthalenedisulphonic acid, compound with triethylamine (1:2)
Modify Date: 2025-09-26 22:50:09
diisononylnaphthalenedisulphonic acid, compound with triethylamine (1:2) structure
|
Common Name | diisononylnaphthalenedisulphonic acid, compound with triethylamine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 63568-33-2 | Molecular Weight | 641.96500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H59NO6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,4-bis(7-methyloctyl)naphthalene-1,2-disulfonic acid,N,N-diethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H59NO6S2 |
|---|---|
| Molecular Weight | 641.96500 |
| Exact Mass | 641.37800 |
| PSA | 128.74000 |
| LogP | 11.14090 |
| InChIKey | UFYSJVOPMKDVBZ-UHFFFAOYSA-N |
| SMILES | CC(C)CCCCCCc1c(S(=O)(=O)O)c(S(=O)(=O)O)c2ccccc2c1CCCCCCC(C)C.CCN(CC)CC.CCN(CC)CC |
| einecs 264-319-9 |