1-(benzhydrylamino)-3-chloropropan-2-ol
Modify Date: 2025-08-26 12:48:04
1-(benzhydrylamino)-3-chloropropan-2-ol structure
|
Common Name | 1-(benzhydrylamino)-3-chloropropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 63477-43-0 | Molecular Weight | 275.77300 | |
| Density | 1.162 g/cm3(Predicted) | Boiling Point | 431.5±45.0 °C(Predicted) | |
| Molecular Formula | C16H18ClNO | Melting Point | 201 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(benzhydrylamino)-3-chloropropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162 g/cm3(Predicted) |
|---|---|
| Boiling Point | 431.5±45.0 °C(Predicted) |
| Melting Point | 201 °C |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.77300 |
| Exact Mass | 275.10800 |
| PSA | 32.26000 |
| LogP | 3.35620 |
| InChIKey | PHDKURQHOBPQTI-UHFFFAOYSA-N |
| SMILES | OC(CCl)CNC(c1ccccc1)c1ccccc1 |
| Storage condition | 2-8°C |
| HS Code | 2922199090 |
|---|
|
~73%
1-(benzhydrylam... CAS#:63477-43-0 |
| Literature: ASTRAZENECA AB; ASTRAZENECA UK LIMITED; BUTTERWORTH, Sam; FINLAY, Maurice, Raymond, Verschoyle; WARD, Richard, Andrew; KADAMBAR, Vasantha, Krishna; CHANDRASHEKAR, Reddy, C.; MURUGAN, Andiappan; REDFEARN, Heather, Marie Patent: WO2013/14448 A1, 2013 ; Location in patent: Page/Page column 96 ; WO 2013/014448 A1 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-chloro-2-hydroxy-3-diphenylmethylaminopropane |
| 3-chloro-1-diphenylmethylamino-2-hydroxypropane |
| 2-Propanol,1-chloro-3-[(diphenylmethyl)amino] |