Acetic acid,2,2-bis([1,1'-biphenyl]-4-yloxy)- structure
|
Common Name | Acetic acid,2,2-bis([1,1'-biphenyl]-4-yloxy)- | ||
|---|---|---|---|---|
| CAS Number | 6345-78-4 | Molecular Weight | 396.43500 | |
| Density | 1.223g/cm3 | Boiling Point | 609.2ºC at 760 mmHg | |
| Molecular Formula | C26H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.7ºC | |
| Name | 2,2-bis(4-phenylphenoxy)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.223g/cm3 |
|---|---|
| Boiling Point | 609.2ºC at 760 mmHg |
| Molecular Formula | C26H20O4 |
| Molecular Weight | 396.43500 |
| Flash Point | 210.7ºC |
| Exact Mass | 396.13600 |
| PSA | 55.76000 |
| LogP | 5.88910 |
| Index of Refraction | 1.625 |
| InChIKey | SROPBHLMQPVUCS-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Oc1ccc(-c2ccccc2)cc1)Oc1ccc(-c2ccccc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| bis(biphenyl-4-yloxy)acetic acid |