2,3,5,6-tetramethyl-1,4-dinitrosopiperazine structure
|
Common Name | 2,3,5,6-tetramethyl-1,4-dinitrosopiperazine | ||
|---|---|---|---|---|
| CAS Number | 63441-59-8 | Molecular Weight | 200.23800 | |
| Density | 1.29g/cm3 | Boiling Point | 368.6ºC at 760 mmHg | |
| Molecular Formula | C8H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.7ºC | |
| Name | 2,3,5,6-tetramethyl-1,4-dinitrosopiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 368.6ºC at 760 mmHg |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.23800 |
| Flash Point | 176.7ºC |
| Exact Mass | 200.12700 |
| PSA | 65.34000 |
| LogP | 1.39660 |
| Index of Refraction | 1.583 |
| InChIKey | OHOJWCVESZTLQZ-UHFFFAOYSA-N |
| SMILES | CC1C(C)N(N=O)C(C)C(C)N1N=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3,5,6-Tetramethyl-N,N'-dinitrosopiperazine |
| Piperazine,1,4-dinitroso-2,3,5,6-tetramethyl |
| 2,3,5,6-Tetramethyldinitrosopiperazine |
| 1,4-Dinitroso-2,3,5,6-tetramethylpiperazine |