ethyl 2-acetyl-5-(dibutylamino)pentanoate
Modify Date: 2025-09-10 09:13:58
ethyl 2-acetyl-5-(dibutylamino)pentanoate structure
|
Common Name | ethyl 2-acetyl-5-(dibutylamino)pentanoate | ||
|---|---|---|---|---|
| CAS Number | 6344-40-7 | Molecular Weight | 299.44900 | |
| Density | 0.943g/cm3 | Boiling Point | 391.1ºC at 760 mmHg | |
| Molecular Formula | C17H33NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
| Name | ethyl 2-acetyl-5-(dibutylamino)pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.943g/cm3 |
|---|---|
| Boiling Point | 391.1ºC at 760 mmHg |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.44900 |
| Flash Point | 190.3ºC |
| Exact Mass | 299.24600 |
| PSA | 46.61000 |
| LogP | 3.43710 |
| Index of Refraction | 1.456 |
| InChIKey | SHSDJEPNRYJHJT-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)CCCC(C(C)=O)C(=O)OCC |
|
~%
ethyl 2-acetyl-... CAS#:6344-40-7 |
| Literature: Perrine Journal of Organic Chemistry, 1953 , vol. 18, p. 1356,1361 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Acetyl-5-dibutylamino-valeriansaeure-aethylester |