Ethanone,1-(3,4-diethoxy-2-hydroxyphenyl)- structure
|
Common Name | Ethanone,1-(3,4-diethoxy-2-hydroxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6342-86-5 | Molecular Weight | 224.25300 | |
| Density | 1.118g/cm3 | Boiling Point | 337ºC at 760 mmHg | |
| Molecular Formula | C12H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.7ºC | |
| Name | 1-(3,4-diethoxy-2-hydroxyphenyl)ethanone |
|---|
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 337ºC at 760 mmHg |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.25300 |
| Flash Point | 124.7ºC |
| Exact Mass | 224.10500 |
| PSA | 55.76000 |
| LogP | 2.39220 |
| Index of Refraction | 1.518 |
| InChIKey | XRHVEAYKYLGKOD-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(C)=O)c(O)c1OCC |
|
~%
Ethanone,1-(3,4... CAS#:6342-86-5 |
| Literature: Gardner et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 2541 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |