Pentanoic acid,2-(2,2-dimethoxyacetyl)-, methyl ester
Modify Date: 2025-08-25 22:31:18
Pentanoic acid,2-(2,2-dimethoxyacetyl)-, methyl ester structure
|
Common Name | Pentanoic acid,2-(2,2-dimethoxyacetyl)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 6342-55-8 | Molecular Weight | 218.24700 | |
| Density | 1.05g/cm3 | Boiling Point | 286.3ºC at 760 mmHg | |
| Molecular Formula | C10H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.1ºC | |
| Name | methyl 2-(2,2-dimethoxyacetyl)pentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 286.3ºC at 760 mmHg |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.24700 |
| Flash Point | 126.1ºC |
| Exact Mass | 218.11500 |
| PSA | 61.83000 |
| LogP | 0.76370 |
| Index of Refraction | 1.429 |
| InChIKey | GMRZBXGCWXWKCJ-UHFFFAOYSA-N |
| SMILES | CCCC(C(=O)OC)C(=O)C(OC)OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4,4-dimethoxy-2-propyl-acetoacetic acid methyl ester |
| 4,4-Dimethoxy-2-propyl-acetessigsaeure-methylester |