2-(1-Pentynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane structure
|
Common Name | 2-(1-Pentynyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | ||
|---|---|---|---|---|
| CAS Number | 634196-62-6 | Molecular Weight | 194.07800 | |
| Density | 0.9057 g/mL at 25ºC | Boiling Point | 68-72ºC/0.09 mmHg | |
| Molecular Formula | C11H19BO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 68ºC | |
| Name | 4,4,5,5-tetramethyl-2-pent-1-ynyl-1,3,2-dioxaborolane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9057 g/mL at 25ºC |
|---|---|
| Boiling Point | 68-72ºC/0.09 mmHg |
| Molecular Formula | C11H19BO2 |
| Molecular Weight | 194.07800 |
| Flash Point | 68ºC |
| Exact Mass | 194.14800 |
| PSA | 18.46000 |
| LogP | 2.42130 |
| Index of Refraction | n20/D 1.4479 |
| InChIKey | RXNSNUUTGWELNS-UHFFFAOYSA-N |
| SMILES | CCCC#CB1OC(C)(C)C(C)(C)O1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1-Pentynylboronic acid pinacol ester |
| 2-(1-PENTYNYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE |