Carbonothioicdihydrazide, 2,2'-bis[(4-chlorophenyl)methylene]- structure
|
Common Name | Carbonothioicdihydrazide, 2,2'-bis[(4-chlorophenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 6340-16-5 | Molecular Weight | 351.25400 | |
| Density | 1.33g/cm3 | Boiling Point | 473.6ºC at 760mmHg | |
| Molecular Formula | C15H12Cl2N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.2ºC | |
| Name | 1,3-bis[(4-chlorophenyl)methylideneamino]thiourea |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 473.6ºC at 760mmHg |
| Molecular Formula | C15H12Cl2N4S |
| Molecular Weight | 351.25400 |
| Flash Point | 240.2ºC |
| Exact Mass | 350.01600 |
| PSA | 80.87000 |
| LogP | 4.60730 |
| Index of Refraction | 1.644 |
| InChIKey | IMPWGGGRTFHXJR-VNIJRHKQSA-N |
| SMILES | S=C(NN=Cc1ccc(Cl)cc1)NN=Cc1ccc(Cl)cc1 |
|
~93%
Carbonothioicdi... CAS#:6340-16-5 |
| Literature: Rajendran, G.; Jain, Sampat R. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 680 - 682 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |