Benzoic acid,4-(3-phenylpropyl)- structure
|
Common Name | Benzoic acid,4-(3-phenylpropyl)- | ||
|---|---|---|---|---|
| CAS Number | 6337-66-2 | Molecular Weight | 240.29700 | |
| Density | 1.133g/cm3 | Boiling Point | 392.5ºC at 760mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.4ºC | |
| Name | 4-(3-phenylpropyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 392.5ºC at 760mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 183.4ºC |
| Exact Mass | 240.11500 |
| PSA | 37.30000 |
| LogP | 3.56010 |
| Index of Refraction | 1.593 |
| InChIKey | LUCNGOVVTMVUGW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(CCCc2ccccc2)cc1 |
|
~%
Benzoic acid,4-... CAS#:6337-66-2 |
| Literature: Allinger; Cram Journal of the American Chemical Society, 1954 , vol. 76, p. 2362,2367 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| hms3080f11 |