phenyl-(6-phenyl-3,4-dihydro-2H-pyran-2-yl)methanone structure
|
Common Name | phenyl-(6-phenyl-3,4-dihydro-2H-pyran-2-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 6337-36-6 | Molecular Weight | 264.31800 | |
| Density | 1.149g/cm3 | Boiling Point | 433.2ºC at 760 mmHg | |
| Molecular Formula | C18H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.1ºC | |
| Name | phenyl-(6-phenyl-3,4-dihydro-2H-pyran-2-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.149g/cm3 |
|---|---|
| Boiling Point | 433.2ºC at 760 mmHg |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.31800 |
| Flash Point | 196.1ºC |
| Exact Mass | 264.11500 |
| PSA | 26.30000 |
| LogP | 4.08940 |
| Index of Refraction | 1.596 |
| InChIKey | PPIMDAAFCHEXEO-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C1CCC=C(c2ccccc2)O1 |
|
~%
phenyl-(6-pheny... CAS#:6337-36-6 |
| Literature: Jacob; Madinaveitia Journal of the Chemical Society, 1937 , p. 1929 |
|
~%
phenyl-(6-pheny... CAS#:6337-36-6 |
| Literature: Alder; Offermanns; Rueden Chemische Berichte, 1941 , vol. 74, p. 927 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| phenyl(6-phenyl-3,4-dihydro-2h-pyran-2-yl)methanone |
| Phenyl-(6-phenyl-3,4-dihydro-2H-pyran-2-yl)-keton |
| 2-Benzoyl-6-phenyl-3,4-dihydro-2H-pyran |
| phenyl-(6-phenyl-3,4-dihydro-2H-pyran-2-yl)-ketone |