1,4-bis(3,4-dichlorophenyl)-3,6-dimethylpiperazine-2,5-dione
Modify Date: 2025-10-31 14:41:43
1,4-bis(3,4-dichlorophenyl)-3,6-dimethylpiperazine-2,5-dione structure
|
Common Name | 1,4-bis(3,4-dichlorophenyl)-3,6-dimethylpiperazine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 63349-35-9 | Molecular Weight | 432.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-bis(3,4-dichlorophenyl)-3,6-dimethylpiperazine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14Cl4N2O2 |
|---|---|
| Molecular Weight | 432.12800 |
| Exact Mass | 429.98100 |
| PSA | 40.62000 |
| LogP | 5.58700 |
| InChIKey | JNLXCEHTUNFSCQ-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(c2ccc(Cl)c(Cl)c2)C(C)C(=O)N1c1ccc(Cl)c(Cl)c1 |
|
~%
1,4-bis(3,4-dic... CAS#:63349-35-9 |
| Literature: Antipanova; Gil'mkhanova; Maslennikova Journal of applied chemistry of the USSR, 1986 , vol. 59, # 1 pt 2 p. 211 - 213 |
|
~%
1,4-bis(3,4-dic... CAS#:63349-35-9 |
| Literature: Antipanova; Gil'mkhanova; Maslennikova Journal of applied chemistry of the USSR, 1986 , vol. 59, # 1 pt 2 p. 211 - 213 |
| 1,4-bis-(3,4-dichloro-phenyl)-3,6-dimethyl-piperazine-2,5-dione |
| 2,5-Piperazinedione,1,4-bis(3,4-dichlorophenyl)-3,6-dimethyl |
| 1,4-<N-3,4-dichlorophenyl>-2,5-dimethyl-3,6-diketopiperazine |