N-Methyl-2,4-dinitro-N-phenyl-6-(trifluoromethyl)aniline structure
|
Common Name | N-Methyl-2,4-dinitro-N-phenyl-6-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 63333-32-4 | Molecular Weight | 341.24200 | |
| Density | 1.475 g/cm3 | Boiling Point | 417ºC at 760 mmHg | |
| Molecular Formula | C14H10F3N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206ºC | |
| Name | N-Methyl-2,4-dinitro-N-phenyl-6-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.475 g/cm3 |
|---|---|
| Boiling Point | 417ºC at 760 mmHg |
| Molecular Formula | C14H10F3N3O4 |
| Molecular Weight | 341.24200 |
| Flash Point | 206ºC |
| Exact Mass | 341.06200 |
| PSA | 94.88000 |
| LogP | 5.33610 |
| Index of Refraction | 1.593 |
| InChIKey | JYCNXMMTVIAGJC-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)c1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(F)(F)F |
|
~%
N-Methyl-2,4-di... CAS#:63333-32-4 |
| Literature: Eli Lilly and Company Patent: US4316988 A1, 1982 ; |
| N-methyl-2,4-dinitro-6-trifluoromethyldiphenylamine |
| S853 |
| EINECS 264-102-9 |