WAY-325006
Modify Date: 2023-10-20 15:13:39
WAY-325006 structure
|
Common Name | WAY-325006 | ||
|---|---|---|---|---|
| CAS Number | 633279-99-9 | Molecular Weight | 416.45 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 657.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C23H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.3±34.3 °C | |
Use of WAY-325006AKS1 inhibitor |
| Name | WAY-325006 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 657.3±65.0 °C at 760 mmHg |
| Molecular Formula | C23H16N2O4S |
| Molecular Weight | 416.45 |
| Flash Point | 351.3±34.3 °C |
| Exact Mass | 416.083069 |
| LogP | 1.51 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.755 |
| InChIKey | WJSRFFNGNHNJLM-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)cc2c3c(c(NS(=O)(=O)c4ccccc4)ccc31)C(=O)c1ccccc1-2 |
| N-(3-Methyl-2,7-dioxo-2,7-dihydro-3H-naphtho[1,2,3-de]quinolin-6-yl)benzenesulfonamide |
| Benzenesulfonamide, N-(2,7-dihydro-3-methyl-2,7-dioxo-3H-naphtho[1,2,3-de]quinolin-6-yl)- |