1H-Pyrrole-3-carbonitrile,2,4,5-triphenyl- structure
|
Common Name | 1H-Pyrrole-3-carbonitrile,2,4,5-triphenyl- | ||
|---|---|---|---|---|
| CAS Number | 63324-77-6 | Molecular Weight | 320.38700 | |
| Density | 1.24g/cm3 | Boiling Point | 527.8ºC at 760 mmHg | |
| Molecular Formula | C23H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.6ºC | |
| Name | 2,4,5-triphenyl-1H-pyrrole-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 527.8ºC at 760 mmHg |
| Molecular Formula | C23H16N2 |
| Molecular Weight | 320.38700 |
| Flash Point | 161.6ºC |
| Exact Mass | 320.13100 |
| PSA | 39.58000 |
| LogP | 5.88738 |
| Index of Refraction | 1.696 |
| InChIKey | LRUBUISFVNHUBS-UHFFFAOYSA-N |
| SMILES | N#Cc1c(-c2ccccc2)[nH]c(-c2ccccc2)c1-c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4,5-triphenyl-pyrrole-3-carbonitrile |