2-Propen-1-one,3-phenyl-1-(2,4,6-trimethylphenyl)- structure
|
Common Name | 2-Propen-1-one,3-phenyl-1-(2,4,6-trimethylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6332-04-3 | Molecular Weight | 250.33500 | |
| Density | 1.048g/cm3 | Boiling Point | 418.9ºC at 760 mmHg | |
| Molecular Formula | C18H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.7ºC | |
| Name | 3-phenyl-1-(2,4,6-trimethylphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.048g/cm3 |
|---|---|
| Boiling Point | 418.9ºC at 760 mmHg |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.33500 |
| Flash Point | 183.7ºC |
| Exact Mass | 250.13600 |
| PSA | 17.07000 |
| LogP | 4.50790 |
| Index of Refraction | 1.599 |
| InChIKey | FLJAEHNSTVEODG-MDZDMXLPSA-N |
| SMILES | Cc1cc(C)c(C(=O)C=Cc2ccccc2)c(C)c1 |
|
~94%
2-Propen-1-one,... CAS#:6332-04-3 |
| Literature: More, Parmeshwar E.; Bandgar, Babasaheb P.; Kamble, Vinod T. Catalysis Communications, 2012 , vol. 27, p. 30 - 32 |
|
~92%
2-Propen-1-one,... CAS#:6332-04-3 |
| Literature: Pinkus, A. G.; Logaraj, S. Tetrahedron, 1988 , vol. 44, # 22 p. 6801 - 6806 |
|
~%
2-Propen-1-one,... CAS#:6332-04-3 |
| Literature: Sales, Zachary S.; Nassar, Roger; Morris, J. Jacob; Henderson, Kenneth W. Journal of Organometallic Chemistry, 2005 , vol. 690, # 14 p. 3474 - 3478 |
| benzalacetomesitylene |
| PhCH=NC6H4-NO2-m |
| ANILINE,N-BENZYLIDENE-m-NITRO |
| mesityl styryl ketone |
| Benzal-m-nitroaniline |
| N-Benzylidene-m-nitroaniline |
| 2',4',6'-Trimethyl-chalkon |
| N-Benzyliden-3-nitro-anilin |
| Benzal-3-nitroaniline |
| WLN: WNR CNU1R |
| 2',4',6'-trimethyl-chalcone |
| benzylidene-2,4,6-trimethylacetophenone |
| N-benzylidene-3-nitro-aniline |