2,4-Imidazolidinedione,5-[(2,4-dichlorophenyl)methylene]- structure
|
Common Name | 2,4-Imidazolidinedione,5-[(2,4-dichlorophenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 6331-80-2 | Molecular Weight | 257.07300 | |
| Density | 1.553g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H6Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(2,4-dichlorophenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.553g/cm3 |
|---|---|
| Molecular Formula | C10H6Cl2N2O2 |
| Molecular Weight | 257.07300 |
| Exact Mass | 255.98100 |
| PSA | 58.20000 |
| LogP | 2.83130 |
| Index of Refraction | 1.661 |
| InChIKey | KXXQLEFIYMXHAL-BAQGIRSFSA-N |
| SMILES | O=C1NC(=O)C(=Cc2ccc(Cl)cc2Cl)N1 |
|
~%
2,4-Imidazolidi... CAS#:6331-80-2 |
| Literature: Ward Journal of the American Chemical Society, 1952 , vol. 74, p. 4212 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Demethyl-trimethoprim |
| 2,4-diamino-<3,4-dimethoxy-5-hydroxybenzyl>pyrimidine |