Benzeneacetic acid,3-nitro-a-oxo- structure
|
Common Name | Benzeneacetic acid,3-nitro-a-oxo- | ||
|---|---|---|---|---|
| CAS Number | 6330-40-1 | Molecular Weight | 195.12900 | |
| Density | 1.531g/cm3 | Boiling Point | 358.6ºC at 760 mmHg | |
| Molecular Formula | C8H5NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162ºC | |
| Name | 2-(3-nitrophenyl)-2-oxoacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.531g/cm3 |
|---|---|
| Boiling Point | 358.6ºC at 760 mmHg |
| Molecular Formula | C8H5NO5 |
| Molecular Weight | 195.12900 |
| Flash Point | 162ºC |
| Exact Mass | 195.01700 |
| PSA | 100.19000 |
| LogP | 1.38530 |
| Index of Refraction | 1.613 |
| InChIKey | WFLZZURFYPMNDF-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)c1cccc([N+](=O)[O-])c1 |
| HS Code | 2918300090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| m-Nitro-phenylglyoxylsaeure |
| 3-Nitro-benzoylameisensaeure |
| Benzeneacetic acid,3-nitro-a-oxo |
| 3-nitrobenzoylformic acid |