Quinazoline,4-methyl-2-[[(3-methylbutyl)thio]methyl]-, 3-oxide structure
|
Common Name | Quinazoline,4-methyl-2-[[(3-methylbutyl)thio]methyl]-, 3-oxide | ||
|---|---|---|---|---|
| CAS Number | 6327-38-4 | Molecular Weight | 276.39700 | |
| Density | 1.14g/cm3 | Boiling Point | 447.5ºC at 760 mmHg | |
| Molecular Formula | C15H20N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.5ºC | |
| Name | 4-methyl-2-(3-methylbutylsulfanylmethyl)-3-oxidoquinazolin-3-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 447.5ºC at 760 mmHg |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.39700 |
| Flash Point | 224.5ºC |
| Exact Mass | 276.13000 |
| PSA | 63.65000 |
| LogP | 4.25100 |
| Index of Refraction | 1.59 |
| InChIKey | HOFGXXTVLSOQFC-UHFFFAOYSA-N |
| SMILES | Cc1c2ccccc2nc(CSCCC(C)C)[n+]1[O-] |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-methyl-2-(3-methyl-butylsulfanylmethyl)-quinazoline 3-oxide |
| Quinazoline,4-methyl-2-[[(3-methylbutyl)thio]methyl]-,3-oxide |
| 4-METHYL-2-(3-METHYLBUTYLSULFANYLMETHYL)-3-OXIDO-QUINAZOLINE |