bis(phenylmethoxy)phosphinic acid; cyclohexanamine
Modify Date: 2025-08-26 18:02:09
bis(phenylmethoxy)phosphinic acid; cyclohexanamine structure
|
Common Name | bis(phenylmethoxy)phosphinic acid; cyclohexanamine | ||
|---|---|---|---|---|
| CAS Number | 6325-34-4 | Molecular Weight | 377.41400 | |
| Density | N/A | Boiling Point | 427.6ºC at 760 mmHg | |
| Molecular Formula | C20H28NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | cyclohexanamine,dibenzyl hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 427.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C20H28NO4P |
| Molecular Weight | 377.41400 |
| Flash Point | 212.4ºC |
| Exact Mass | 377.17600 |
| PSA | 91.59000 |
| LogP | 5.49850 |
| InChIKey | CMRGXPWSGCXILM-UHFFFAOYSA-N |
| SMILES | NC1CCCCC1.O=P(O)(OCc1ccccc1)OCc1ccccc1 |
| HS Code | 2922199090 |
|---|
|
~%
bis(phenylmetho... CAS#:6325-34-4 |
| Literature: Trowbridge; Yamamoto; Kenyon Journal of the American Chemical Society, 1972 , vol. 94, # 11 p. 3816 - 3824 |
![2,4,6-trioxo-2λ5,4λ5,6λ5-[1,2,4,6]oxatriphosphinane-2,4,6-triol, tris-cyclohexylamine salt structure](https://image.chemsrc.com/caspic/250/30798-15-3.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Cyclohexylamin,Salz des Phosphorsaeure-dibenzylesters |
| Phosphorsaeure-dibenzylester,Verbindung mit Cyclohexylamin |
| phosphoric acid dibenzyl ester,compound with cyclohexylamine |
| Cyclohexylammoniumdibenzylphosphat |