ethyl 2-acetamido-5-methylbenzoate
ethyl 2-acetamido-5-methylbenzoate structure
|
Common Name | ethyl 2-acetamido-5-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 63243-79-8 | Molecular Weight | 221.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-acetamido-5-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15NO3 |
|---|---|
| Molecular Weight | 221.25200 |
| Exact Mass | 221.10500 |
| PSA | 58.89000 |
| LogP | 2.77960 |
| InChIKey | RNKSQLLCRNVATF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C)ccc1NC(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~61%
ethyl 2-acetami... CAS#:63243-79-8 |
| Literature: Wang, Sizhuo; Yang, Zhiyong; Liu, Jidan; Xie, Kai; Wang, Anwei; Chen, Xiang; Tan, Ze Chemical Communications, 2012 , vol. 48, # 79 p. 9924 - 9926 |
|
~%
ethyl 2-acetami... CAS#:63243-79-8 |
| Literature: Horino, Hiroshi; Inoue, Naoto Journal of Organic Chemistry, 1981 , vol. 46, p. 4416 - 4422 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Ethyl-N-acetyl-5-methylanthranilat |
| 2-acetylamino-5-methylbenzoic acid ethyl ester |
| Benzoic acid,2-(acetylamino)-5-methyl-,ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of ethyl 2-acetamido-5-methylbenzoate? |
| A: InChIKey of ethyl 2-acetamido-5-methylbenzoate is RNKSQLLCRNVATF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 2-acetamido-5-methylbenzoate? |
| A: Molecular weight of ethyl 2-acetamido-5-methylbenzoate is 221.25200. |
| Q: What is the Chinese name of 63243-79-8? |
| A: Chinese name of 63243-79-8 is 63243-79-8. |
| Q: What is the SMILES notation of ethyl 2-acetamido-5-methylbenzoate? |
| A: SMILES notation of ethyl 2-acetamido-5-methylbenzoate is CCOC(=O)c1cc(C)ccc1NC(C)=O. |
| Q: What is the CAS number of ethyl 2-acetamido-5-methylbenzoate? |
| A: CAS number of ethyl 2-acetamido-5-methylbenzoate is 63243-79-8. |
| Q: What is the LogP of ethyl 2-acetamido-5-methylbenzoate? |
| A: LogP of ethyl 2-acetamido-5-methylbenzoate is 2.77960. |
| Q: What is the molecular formula of ethyl 2-acetamido-5-methylbenzoate? |
| A: Molecular formula of ethyl 2-acetamido-5-methylbenzoate is C12H15NO3. |
| Q: What is the polar surface area (PSA) of ethyl 2-acetamido-5-methylbenzoate? |
| A: Polar surface area (PSA) of ethyl 2-acetamido-5-methylbenzoate is 58.89000. |
| Q: What is the English name of ethyl 2-acetamido-5-methylbenzoate? |
| A: The English name of ethyl 2-acetamido-5-methylbenzoate is ethyl 2-acetamido-5-methylbenzoate. |
| Q: What English synonyms does ethyl 2-acetamido-5-methylbenzoate have? |
| A: English synonyms of ethyl 2-acetamido-5-methylbenzoate: Ethyl-N-acetyl-5-methylanthranilat, 2-acetylamino-5-methylbenzoic acid ethyl ester, Benzoic acid,2-(acetylamino)-5-methyl-,ethyl ester. |