KW-6055
Modify Date: 2025-08-27 11:07:19
KW-6055 structure
|
Common Name | KW-6055 | ||
|---|---|---|---|---|
| CAS Number | 63233-46-5 | Molecular Weight | 299.32400 | |
| Density | 1.247g/cm3 | Boiling Point | 492.6ºC at 760mmHg | |
| Molecular Formula | C16H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.7ºC | |
Use of KW-6055KW-6055 is a benzylpyridine derivative and has anti-amnesic activity. |
| Name | N-[3-nitro-4-(pyridin-2-ylmethyl)phenyl]butanamide |
|---|---|
| Synonym | More Synonyms |
| Description | KW-6055 is a benzylpyridine derivative and has anti-amnesic activity. |
|---|---|
| Related Catalog | |
| In Vivo | KW-6055 is a benzylpyridine derivative and has anti-amnesic activity. KW-6055 (40, 160 mg/kg, p.o.) increases the extracellular level of ACh in normal rats (257±23, 202±24%). In basal forebrain-lesioned rats, KW-6055 (40 mg/kg, p.o.) significantly increases the extracellular level of ACh (251±22%) for more than 2 hr, which is longer than in normal rats[1]. |
| References |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 492.6ºC at 760mmHg |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.32400 |
| Flash Point | 251.7ºC |
| Exact Mass | 299.12700 |
| PSA | 91.30000 |
| LogP | 4.49190 |
| InChIKey | CZKQVCYQBJJAGG-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Nc1ccc(Cc2ccccn2)c([N+](=O)[O-])c1 |
| Storage condition | 2-8℃ |
| N-(3-Nitro-4-(2-pyridinylmethyl)phenyl)butanamide |
| 2-(4-Butyrylamino-2-nitrobenzyl)pyridine |
| KW 6055 |
| Butanamide,N-(3-nitro-4-(2-pyridinylmethyl)phenyl) |
| KW-6055 |