3-benzyl-5-methyl-1,3-thiazolidine-2,4-dione
Modify Date: 2025-11-30 16:30:30
3-benzyl-5-methyl-1,3-thiazolidine-2,4-dione structure
|
Common Name | 3-benzyl-5-methyl-1,3-thiazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 63205-37-8 | Molecular Weight | 221.27600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-benzyl-5-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11NO2S |
|---|---|
| Molecular Weight | 221.27600 |
| Exact Mass | 221.05100 |
| PSA | 62.68000 |
| LogP | 2.20840 |
| InChIKey | HNYRZTPLIYUSTD-UHFFFAOYSA-N |
| SMILES | CC1SC(=O)N(Cc2ccccc2)C1=O |
|
~%
3-benzyl-5-meth... CAS#:63205-37-8 |
| Literature: Shyam,R.; Tiwari,I.C. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 514 - 516 |
| 3-benzyl-5-methyl-thiazolidine-2,4-dione |
| 3-Benzyl-5-methyl-2,4-thiazolidindion |
| 2,4-Thiazolidinedione,5-methyl-3-(phenylmethyl) |