3-phenoxyphthalic acid structure
|
Common Name | 3-phenoxyphthalic acid | ||
|---|---|---|---|---|
| CAS Number | 63196-12-3 | Molecular Weight | 258.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-phenoxyphthalic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10O5 |
|---|---|
| Molecular Weight | 258.22600 |
| Exact Mass | 258.05300 |
| PSA | 83.83000 |
| LogP | 2.87530 |
| InChIKey | HRMCXDSWURAYFR-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(Oc2ccccc2)c1C(=O)O |
|
~%
3-phenoxyphthal... CAS#:63196-12-3 |
| Literature: Derkacheva, V. M.; Luk'yanets, E. A. J. Gen. Chem. USSR (Engl. Transl.), 1980 , vol. 50, # 10 p. 2313 - 2318,1874 - 1878 |
|
~%
3-phenoxyphthal... CAS#:63196-12-3 |
| Literature: Goldberg; Wragg Journal of the Chemical Society, 1958 , p. 4227,4230 |
| 3-phenoxybenzene-1,2-dicarboxylic acid |
| 1,2-Benzenedicarboxylic acid,3-phenoxy |
| 3-Phenoxyphthalsaeure |
| 3-phenoxy-phthalic acid |