3-(P-TOLYLOXY)PHTHALIC ACID structure
|
Common Name | 3-(P-TOLYLOXY)PHTHALIC ACID | ||
|---|---|---|---|---|
| CAS Number | 63181-80-6 | Molecular Weight | 272.25300 | |
| Density | 1.352g/cm3 | Boiling Point | 443.2ºC at 760 mmHg | |
| Molecular Formula | C15H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.2ºC | |
| Name | 3-(4-Methylphenoxy)phthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 443.2ºC at 760 mmHg |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.25300 |
| Flash Point | 167.2ºC |
| Exact Mass | 272.06800 |
| PSA | 83.83000 |
| LogP | 3.18370 |
| Index of Refraction | 1.627 |
| InChIKey | MASDIQOFNICMGE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Oc2cccc(C(=O)O)c2C(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-p-Tolyloxyphthalsaeure |