1-nitro-4-[(2,3,4,5-tetrachloro-1-cyclopenta-2,4-dienylidene)methyl]benzene structure
|
Common Name | 1-nitro-4-[(2,3,4,5-tetrachloro-1-cyclopenta-2,4-dienylidene)methyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 63161-03-5 | Molecular Weight | 336.98600 | |
| Density | 1.62g/cm3 | Boiling Point | 343.2ºC at 760 mmHg | |
| Molecular Formula | C12H5Cl4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.4ºC | |
| Name | 1-nitro-4-[(2,3,4,5-tetrachlorocyclopenta-2,4-dien-1-ylidene)methyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 343.2ºC at 760 mmHg |
| Molecular Formula | C12H5Cl4NO2 |
| Molecular Weight | 336.98600 |
| Flash Point | 161.4ºC |
| Exact Mass | 334.90700 |
| PSA | 45.82000 |
| LogP | 5.89340 |
| Index of Refraction | 1.661 |
| InChIKey | IMKHPTXYFMGMDE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=C2C(Cl)=C(Cl)C(Cl)=C2Cl)cc1 |
| HS Code | 2904909090 |
|---|
|
~%
1-nitro-4-[(2,3... CAS#:63161-03-5 |
| Literature: Meek; Argabright Journal of Organic Chemistry, 1957 , vol. 22, p. 1708 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (4-Nitro-phenyl)-tetrachlorcyclopentadienyliden-methan |
| 1-Nitro-4-[(2,3,4,5-tetrachloro-2,4-cyclopentadien-1-ylidene)methyl]benzene |
| (4-nitro-phenyl)-tetrachlorocyclopentadienylidene-methane |
| 1.2.3.4.-Tetrachlor-6-(p-nitrophenyl)fulven |
| (2,3,4,5-Tetrachloro-2,4-cyclopentadienylidene)-(p-nitrophenyl)methane |