naphthalen-2-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate
Modify Date: 2025-08-26 19:38:34
naphthalen-2-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate structure
|
Common Name | naphthalen-2-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 6316-50-3 | Molecular Weight | 294.38700 | |
| Density | 1.127g/cm3 | Boiling Point | 405.4ºC at 760 mmHg | |
| Molecular Formula | C20H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.9ºC | |
| Name | naphthalen-2-yl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 405.4ºC at 760 mmHg |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.38700 |
| Flash Point | 132.9ºC |
| Exact Mass | 294.16200 |
| PSA | 26.30000 |
| LogP | 4.98360 |
| Index of Refraction | 1.622 |
| InChIKey | KKIDROWKOWAIII-UHFFFAOYSA-N |
| SMILES | CC(C)=CC1C(C(=O)Oc2ccc3ccccc3c2)C1(C)C |
|
~%
naphthalen-2-yl... CAS#:6316-50-3 |
| Literature: Alexander,B.H. et al. Journal of Organic Chemistry, 1960 , vol. 25, p. 626 - 632 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Chrysanthemumsaeure-(naphthyl-(2)-ester) |
| naphthalen-2-yl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate |