ethyl 6-[(4-chloro-2-sulphophenyl)amino]-2,7-dihydro-3-methyl-2,7-dioxo-3H-dibenz[f,ij]isoquinoline-1-carboxylate structure
|
Common Name | ethyl 6-[(4-chloro-2-sulphophenyl)amino]-2,7-dihydro-3-methyl-2,7-dioxo-3H-dibenz[f,ij]isoquinoline-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 63149-10-0 | Molecular Weight | 538.95600 | |
| Density | 1.62g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H19ClN2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-ethoxycarbonyl-3-methyl-2,7-dioxo-2,7-dihydro-3H-naphtho[1,2,3-de]quinolin-6-ylamino)-5-chloro-benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Molecular Formula | C26H19ClN2O7S |
| Molecular Weight | 538.95600 |
| Exact Mass | 538.06000 |
| PSA | 140.15000 |
| LogP | 5.61710 |
| Index of Refraction | 1.74 |
| InChIKey | XAVDJYWQEBDPNQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c2c3c(c(Nc4ccc(Cl)cc4S(=O)(=O)O)ccc3n(C)c1=O)C(=O)c1ccccc1-2 |
|
~%
ethyl 6-[(4-chl... CAS#:63149-10-0 |
| Literature: Allen et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 585,587 |
| 1H-Indene-1,3(2H)-dione,2-(1-ethoxyethylidene) |
| 2(1'-Aethoxyaethyliden)indandion |
| 2-(1-Aethoxycarbonyl-3-methyl-2,7-dioxo-2,7-dihydro-3H-naphtho[1,2,3-de]chinolin-6-ylamino)-5-chlor-benzolsulfonsaeure |
| 2-(1-Aethoxy-aethyliden)-indan-1,3-dion |
| ethyl 6-[(4-chloro-2-sulfophenyl)amino]-2,7-dihydro-3-methyl-2,7-dioxo-3H-dibenz(f,ij)isoquinoline-1-carboxylate |
| 2-(ethoxyethylidene)cyclopenta[1,2-a]benzene-1,3-dione |
| 2-(1-ethoxy-ethylidene)-indan-1,3-dione |