2-(2-(2-(4-Nitrophenoxy)Ethoxy)Ethoxy)Ethanol structure
|
Common Name | 2-(2-(2-(4-Nitrophenoxy)Ethoxy)Ethoxy)Ethanol | ||
|---|---|---|---|---|
| CAS Number | 63134-26-9 | Molecular Weight | 271.26600 | |
| Density | 1.244g/cm3 | Boiling Point | 427.8ºC at 760 mmHg | |
| Molecular Formula | C12H17NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.6ºC | |
| Name | 2-[2-[2-(4-nitrophenoxy)ethoxy]ethoxy]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 427.8ºC at 760 mmHg |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.26600 |
| Flash Point | 212.6ºC |
| Exact Mass | 271.10600 |
| PSA | 93.74000 |
| LogP | 1.52230 |
| Index of Refraction | 1.532 |
| InChIKey | HHMZBDBWIQZVMN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCOCCOCCO)cc1 |
| HS Code | 2909499000 |
|---|
|
~0%
2-(2-(2-(4-Nitr... CAS#:63134-26-9
Detail
|
| Literature: Malykhin, E. V.; Shteingarts, V. D. Russian Journal of Applied Chemistry, 2012 , vol. 85, # 8 p. 1232 - 1238,7 |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-{2-[2-(4-nitrophenoxy)ethoxy]ethoxy}ethanol |
| 1,2-bis[2-(4-nitrophenoxy)ethoxy]ethane |
| 1-(4'-nitrophenoxy)-8-hydroxy-3,6-dioxaoctane |
| Ethanol,2-(2-(2-(4-nitrophenoxy)ethoxy)ethoxy) |