2-Pyridineethanamine,N,N-bis(2-methylpropyl)- structure
|
Common Name | 2-Pyridineethanamine,N,N-bis(2-methylpropyl)- | ||
|---|---|---|---|---|
| CAS Number | 6312-33-0 | Molecular Weight | 234.38000 | |
| Density | 0.917g/cm3 | Boiling Point | 313.8ºC at 760mmHg | |
| Molecular Formula | C15H26N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.6ºC | |
| Name | 2-methyl-N-(2-methylpropyl)-N-(2-pyridin-2-ylethyl)propan-1-amine |
|---|
| Density | 0.917g/cm3 |
|---|---|
| Boiling Point | 313.8ºC at 760mmHg |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.38000 |
| Flash Point | 143.6ºC |
| Exact Mass | 234.21000 |
| PSA | 16.13000 |
| LogP | 3.23810 |
| Index of Refraction | 1.495 |
| InChIKey | AZNOMAOOEYWAKX-UHFFFAOYSA-N |
| SMILES | CC(C)CN(CCc1ccccn1)CC(C)C |
|
~38%
2-Pyridineethan... CAS#:6312-33-0 |
| Literature: Cohen; Baumgold; Jin; De la Cruz; Rzeszotarski; Reba Journal of Medicinal Chemistry, 1993 , vol. 36, # 1 p. 162 - 165 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |