2-bromo-1,3-diiodo-5-nitro-benzene structure
|
Common Name | 2-bromo-1,3-diiodo-5-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 6311-50-8 | Molecular Weight | 453.79900 | |
| Density | 2.808g/cm3 | Boiling Point | 409.4ºC at 760 mmHg | |
| Molecular Formula | C6H2BrI2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.4ºC | |
| Name | 2-bromo-1,3-diiodo-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.808g/cm3 |
|---|---|
| Boiling Point | 409.4ºC at 760 mmHg |
| Molecular Formula | C6H2BrI2NO2 |
| Molecular Weight | 453.79900 |
| Flash Point | 201.4ºC |
| Exact Mass | 452.73600 |
| PSA | 45.82000 |
| LogP | 4.08970 |
| Index of Refraction | 1.757 |
| InChIKey | TUNTVWMBCNWDQA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(I)c(Br)c(I)c1 |
| HS Code | 2904909090 |
|---|
|
~43%
2-bromo-1,3-dii... CAS#:6311-50-8 |
| Literature: Tao, Weijin; Nesbitt, Stephanie; Heck, Richard F. Journal of Organic Chemistry, 1990 , vol. 55, # 1 p. 63 - 69 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,2-bromo-1,3-dichloro-5-nitro |
| 4-Bromo-3,5-diiodonitrobenzene |
| 2-Brom-1,3-dijod-5-nitro-benzol |
| 3.5-Dichlor-4-brom-1-nitro-benzol |
| 2-Brom-1,3-dichlor-5-nitro-benzol |
| 4-bromo-3,5-dichloro-nitrobenzene |
| 1-bromo-2,6-dichloro-4-nitrobenzene |
| 2-bromo-1,3-dichloro-5-nitro-benzene |
| 2-bromo-1,3-diiodo-5-nitro-benzene |