2-Pentanone, 4,4-(1,2-ethanediyldinitrilo)bis- structure
|
Common Name | 2-Pentanone, 4,4-(1,2-ethanediyldinitrilo)bis- | ||
|---|---|---|---|---|
| CAS Number | 6310-76-5 | Molecular Weight | 224.29900 | |
| Density | 0.99g/cm3 | Boiling Point | 336.2ºC at 760 mmHg | |
| Molecular Formula | C12H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138ºC | |
| Name | 4-[2-(4-oxopentan-2-ylideneamino)ethylimino]pentan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 336.2ºC at 760 mmHg |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.29900 |
| Flash Point | 138ºC |
| Exact Mass | 224.15200 |
| PSA | 58.86000 |
| LogP | 1.86640 |
| Index of Refraction | 1.485 |
| InChIKey | PZRFMNQRPVQCIT-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)=NCCN=C(C)CC(C)=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| hms2446i11 |