Benzeneethanol, a-(chloromethyl)-3-(trifluoromethyl)-
Modify Date: 2025-09-13 18:14:17
Benzeneethanol, a-(chloromethyl)-3-(trifluoromethyl)- structure
|
Common Name | Benzeneethanol, a-(chloromethyl)-3-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 6310-15-2 | Molecular Weight | 238.63400 | |
| Density | 1.314g/cm3 | Boiling Point | 272.9ºC at 760 mmHg | |
| Molecular Formula | C10H10ClF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.8ºC | |
| Name | 1-chloro-3-[3-(trifluoromethyl)phenyl]propan-2-ol |
|---|
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 272.9ºC at 760 mmHg |
| Molecular Formula | C10H10ClF3O |
| Molecular Weight | 238.63400 |
| Flash Point | 118.8ºC |
| Exact Mass | 238.03700 |
| PSA | 20.23000 |
| LogP | 2.84760 |
| Index of Refraction | 1.482 |
| InChIKey | ZFXGKQTVBSBJSU-UHFFFAOYSA-N |
| SMILES | OC(CCl)Cc1cccc(C(F)(F)F)c1 |
| HS Code | 2906299090 |
|---|
|
~%
Benzeneethanol,... CAS#:6310-15-2 |
| Literature: Barron,D.I. et al. Journal of Medicinal Chemistry, 1968 , vol. 11, p. 1139 - 1144 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |