Phosphoric acid, tris(2-chlorophenyl) ester structure
|
Common Name | Phosphoric acid, tris(2-chlorophenyl) ester | ||
|---|---|---|---|---|
| CAS Number | 631-44-7 | Molecular Weight | 429.61800 | |
| Density | 1.462g/cm3 | Boiling Point | 465.2ºC at 760 mmHg | |
| Molecular Formula | C18H12Cl3O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 387.8ºC | |
| Name | tris(2-chlorophenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.462g/cm3 |
|---|---|
| Boiling Point | 465.2ºC at 760 mmHg |
| Molecular Formula | C18H12Cl3O4P |
| Molecular Weight | 429.61800 |
| Flash Point | 387.8ºC |
| Exact Mass | 427.95400 |
| PSA | 54.57000 |
| LogP | 7.29170 |
| Index of Refraction | 1.613 |
| InChIKey | LFRFOEVCFVCHEV-UHFFFAOYSA-N |
| SMILES | O=P(Oc1ccccc1Cl)(Oc1ccccc1Cl)Oc1ccccc1Cl |
|
~91%
Phosphoric acid... CAS#:631-44-7 |
| Literature: Sagar; Shinde; Bandgar Organic Preparations and Procedures International, 2000 , vol. 32, # 3 p. 269 - 271 |
|
~%
Phosphoric acid... CAS#:631-44-7 |
| Literature: Kamai; Koschkina Trudy Kazansk. chim. technol. Inst.Chem.Abstr., 1952 , # 17 p. 11,17 Trudy Kazansk. chim. technol. Inst.Chem.Abstr., 1956 , p. 6346 |
|
~90%
Phosphoric acid... CAS#:631-44-7 |
| Literature: Sagar; Thorat; Salunkhe Synthetic Communications, 1994 , vol. 24, # 14 p. 2029 - 2033 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-chlorophenyl phosphate |