Arsine,diiodo(m-nitrophenyl)- (8CI)
Modify Date: 2025-09-20 19:08:49
Arsine,diiodo(m-nitrophenyl)- (8CI) structure
|
Common Name | Arsine,diiodo(m-nitrophenyl)- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 6308-57-2 | Molecular Weight | 450.83200 | |
| Density | N/A | Boiling Point | 389.4ºC at 760 mmHg | |
| Molecular Formula | C6H4AsI2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.3ºC | |
| Name | diiodo-(3-nitrophenyl)arsane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 389.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H4AsI2NO2 |
| Molecular Weight | 450.83200 |
| Flash Point | 189.3ºC |
| Exact Mass | 450.75500 |
| PSA | 45.82000 |
| LogP | 2.68320 |
| InChIKey | UPLFXXCCZJERDI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc([As](I)I)c1 |
| HS Code | 2931900090 |
|---|
|
~%
Arsine,diiodo(m... CAS#:6308-57-2 |
| Literature: Blicke; Powers Journal of the American Chemical Society, 1932 , vol. 54, p. 2945 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (3-nitrophenyl)arsonous diiodide |
| diiodo-(3-nitro-phenyl)-arsine |
| Dijod-(3-nitro-phenyl)-arsin |