5-(4-chlorophenyl)-5-ethyl-imidazolidine-2,4-dione
Modify Date: 2025-11-21 17:46:02
5-(4-chlorophenyl)-5-ethyl-imidazolidine-2,4-dione structure
|
Common Name | 5-(4-chlorophenyl)-5-ethyl-imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 6308-24-3 | Molecular Weight | 238.67000 | |
| Density | 1.283g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-chlorophenyl)-5-ethylimidazolidine-2,4-dione |
|---|
| Density | 1.283g/cm3 |
|---|---|
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67000 |
| Exact Mass | 238.05100 |
| PSA | 58.20000 |
| LogP | 2.44230 |
| Index of Refraction | 1.551 |
| InChIKey | XBVKEJXBZSEZMZ-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=O)NC1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |