Benzoic acid,2-chloro-, 2,3-dibromopropyl ester structure
|
Common Name | Benzoic acid,2-chloro-, 2,3-dibromopropyl ester | ||
|---|---|---|---|---|
| CAS Number | 6308-17-4 | Molecular Weight | 356.43800 | |
| Density | 1.79g/cm3 | Boiling Point | 386.6ºC at 760 mmHg | |
| Molecular Formula | C10H9Br2ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.6ºC | |
| Name | 2,3-dibromopropyl 2-chlorobenzoate |
|---|
| Density | 1.79g/cm3 |
|---|---|
| Boiling Point | 386.6ºC at 760 mmHg |
| Molecular Formula | C10H9Br2ClO2 |
| Molecular Weight | 356.43800 |
| Flash Point | 187.6ºC |
| Exact Mass | 353.86600 |
| PSA | 26.30000 |
| LogP | 3.65520 |
| Index of Refraction | 1.594 |
| InChIKey | LLYXWJQLCPTCNB-UHFFFAOYSA-N |
| SMILES | O=C(OCC(Br)CBr)c1ccccc1Cl |
|
~%
Benzoic acid,2-... CAS#:6308-17-4 |
| Literature: Nayler Journal of the Chemical Society, 1959 , p. 189,193 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |