Benzenepropanoic acid, a-(3-methylbutyl)-b-oxo-, ethyl ester
Modify Date: 2025-09-20 09:35:17
Benzenepropanoic acid, a-(3-methylbutyl)-b-oxo-, ethyl ester structure
|
Common Name | Benzenepropanoic acid, a-(3-methylbutyl)-b-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6305-62-0 | Molecular Weight | 262.34400 | |
| Density | 1.019g/cm3 | Boiling Point | 340ºC at 760 mmHg | |
| Molecular Formula | C16H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.1ºC | |
| Name | ethyl 2-benzoyl-5-methylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.019g/cm3 |
|---|---|
| Boiling Point | 340ºC at 760 mmHg |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.34400 |
| Flash Point | 145.1ºC |
| Exact Mass | 262.15700 |
| PSA | 43.37000 |
| LogP | 3.48480 |
| Index of Refraction | 1.495 |
| InChIKey | NEGHEQTZPWCFSR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCC(C)C)C(=O)c1ccccc1 |
| HS Code | 2918300090 |
|---|
|
~%
Benzenepropanoi... CAS#:6305-62-0 |
| Literature: Abrams; Kipping Journal of the Chemical Society, 1936 , p. 1480 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ETHYL 2-BENZOYL-5-METHYL-HEXANOATE |
| 2-benzoyl-5-methyl-hexanoic acid ethyl ester |
| 2-Benzoyl-5-methyl-hexansaeure-aethylester |
| (+-)-3-Oxo-2-isopentyl-3-phenyl-propionsaeure-aethylester |