3-methyl-1,2-dihydrobenzo[j]aceanthrylene-1,2-diol,2,4,6-trinitrophenol
Modify Date: 2025-09-25 21:19:17
![3-methyl-1,2-dihydrobenzo[j]aceanthrylene-1,2-diol,2,4,6-trinitrophenol Structure](https://image.chemsrc.com/caspic/253/63041-80-5.png)
3-methyl-1,2-dihydrobenzo[j]aceanthrylene-1,2-diol,2,4,6-trinitrophenol structure
|
Common Name | 3-methyl-1,2-dihydrobenzo[j]aceanthrylene-1,2-diol,2,4,6-trinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 63041-80-5 | Molecular Weight | 529.45400 | |
| Density | N/A | Boiling Point | 591.6ºC at 760 mmHg | |
| Molecular Formula | C27H19N3O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.6ºC | |
| Name | 3-methyl-1,2-dihydrobenzo[j]aceanthrylene-1,2-diol,2,4,6-trinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 591.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C27H19N3O9 |
| Molecular Weight | 529.45400 |
| Flash Point | 284.6ºC |
| Exact Mass | 529.11200 |
| PSA | 198.15000 |
| LogP | 7.22140 |
| InChIKey | RHOJZLWOEBOBKP-UHFFFAOYSA-N |
| SMILES | Cc1ccc2cc3c(ccc4ccccc43)c3c2c1C(O)C3O.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| 20-Methylcholanthrene picrate |
| 2,4,6-Trinitrophenol compd. with 1,2-dihydro-3-methylbenz(j)aceanthrylene |
| Picric acid,compd. with 3-methylcholanthrene (1:1) |
| 3-Methylcholanthrene compd. with picric acid (1:1) |
| Benz(j)aceanthrylene,1,2-dihydro-3-methyl-,compd. with 2,4,6-trinitrophenol (1:1) |
| 1,2-Dihydro-3-methylbenz(j)aceanthrylene compd. wth 2,4,6-trinitrophenol (1:1) |