3-methyl-1,2-dihydrobenzo[j]aceanthrylene,1,3,5-trinitrobenzene structure
|
Common Name | 3-methyl-1,2-dihydrobenzo[j]aceanthrylene,1,3,5-trinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 63040-09-5 | Molecular Weight | 481.45600 | |
| Density | N/A | Boiling Point | 506.4ºC at 760 mmHg | |
| Molecular Formula | C27H19N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.2ºC | |
| Name | 3-methyl-1,2-dihydrobenzo[j]aceanthrylene,1,3,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 506.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C27H19N3O6 |
| Molecular Weight | 481.45600 |
| Flash Point | 253.2ºC |
| Exact Mass | 481.12700 |
| PSA | 137.46000 |
| LogP | 8.53400 |
| InChIKey | FALRHHLZEYSKIO-UHFFFAOYSA-N |
| SMILES | Cc1ccc2cc3c(ccc4ccccc43)c3c2c1CC3.O=[N+]([O-])c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| Benz(j)aceanthrylene,1,2-dihydro-3-methyl-,compd. with 1,3,5-trinitrobenzene (1:1) |
| Cholanthrene,3-methyl-,compd. with 1,3,5-trinitrobenzene (1:1) |
| 20-Methylcholanthrene-trinitrobenzene |