2,4,6-trimethyl-N-(2,4,6-trimethylbenzoyl)benzohydrazide
Modify Date: 2024-07-18 09:29:29
2,4,6-trimethyl-N-(2,4,6-trimethylbenzoyl)benzohydrazide structure
|
Common Name | 2,4,6-trimethyl-N-(2,4,6-trimethylbenzoyl)benzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 6304-44-5 | Molecular Weight | 324.41700 | |
| Density | 1.097g/cm3 | Boiling Point | 571ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | 2,4,6-trimethyl-N'-(2,4,6-trimethylbenzoyl)benzohydrazide |
|---|
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 571ºC at 760 mmHg |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.41700 |
| Flash Point | 197.7ºC |
| Exact Mass | 324.18400 |
| PSA | 58.20000 |
| LogP | 4.39360 |
| Index of Refraction | 1.572 |
| InChIKey | SAGKWZFIGYOCNK-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)NNC(=O)c2c(C)cc(C)cc2C)c(C)c1 |
|
~%
2,4,6-trimethyl... CAS#:6304-44-5 |
| Literature: Newman; Caflisch Journal of the American Chemical Society, 1958 , vol. 80, p. 862 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |