1-bromo-2-iodo-4-nitro-benzene structure
|
Common Name | 1-bromo-2-iodo-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 63037-63-8 | Molecular Weight | 327.90200 | |
| Density | 2.349g/cm3 | Boiling Point | 330.6ºC at 760mmHg | |
| Molecular Formula | C6H3BrINO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.8ºC | |
| Name | 1-bromo-2-iodo-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.349g/cm3 |
|---|---|
| Boiling Point | 330.6ºC at 760mmHg |
| Molecular Formula | C6H3BrINO2 |
| Molecular Weight | 327.90200 |
| Flash Point | 153.8ºC |
| Exact Mass | 326.83900 |
| PSA | 45.82000 |
| LogP | 3.48510 |
| InChIKey | AWBNZHRQRUEANT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Br)c(I)c1 |
|
~74%
1-bromo-2-iodo-... CAS#:63037-63-8 |
| Literature: Olah, George A.; Wang, Qi; Sandford, Graham; Prakash, G. K. Surya Journal of Organic Chemistry, 1993 , vol. 58, # 11 p. 3194 - 3195 |
|
~%
1-bromo-2-iodo-... CAS#:63037-63-8 |
| Literature: Case Journal of the American Chemical Society, 1943 , vol. 65, p. 2137 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1-Brom-2-jod-4-nitro-benzol |
| 1-bromo-2-iodo-4-nitro-benzene |
| 4-nitro-1-bromo-2-iodobenzene |
| 4-Bromo-3-iodonitrobenzene |