Benz[a]anthracene-7,12-dimethanol=diacetate
Modify Date: 2025-09-18 16:18:20
![Benz[a]anthracene-7,12-dimethanol=diacetate Structure](https://image.chemsrc.com/caspic/400/63018-62-2.png)
Benz[a]anthracene-7,12-dimethanol=diacetate structure
|
Common Name | Benz[a]anthracene-7,12-dimethanol=diacetate | ||
|---|---|---|---|---|
| CAS Number | 63018-62-2 | Molecular Weight | 372.41300 | |
| Density | 1.252g/cm3 | Boiling Point | 559.2ºC at 760 mmHg | |
| Molecular Formula | C24H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287ºC | |
| Name | [12-(acetyloxymethyl)benzo[a]anthracen-7-yl]methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 559.2ºC at 760 mmHg |
| Molecular Formula | C24H20O4 |
| Molecular Weight | 372.41300 |
| Flash Point | 287ºC |
| Exact Mass | 372.13600 |
| PSA | 52.60000 |
| LogP | 5.27240 |
| Index of Refraction | 1.674 |
| InChIKey | XHCONXDVEAQFIQ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1c2ccccc2c(COC(C)=O)c2c1ccc1ccccc12 |
|
~%
Benz[a]anthrace... CAS#:63018-62-2 |
| Literature: Badger; Cook Journal of the Chemical Society, 1939 , p. 802,805 |
|
~%
Benz[a]anthrace... CAS#:63018-62-2 |
| Literature: Badger; Cook Journal of the Chemical Society, 1939 , p. 802,805 |
![Benz[a]anthracene, 7,12-bis(bromomethyl)- structure](https://image.chemsrc.com/caspic/104/34331-98-1.png)
| 9,10-Bisacetoxymethyl-1,2-benzanthracene |
| 7,12-Diacetoxymethylbenz<a>anthracen |